Compound Q&A

What are the main uses of 4-Oxo-4-({(2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydro-2H-chromen-6-yl}oxy)butanoic acid (CAS: 4345-03-3)?

Answer

4-Oxo-4-({(2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydro-2H-chromen-6-yl}oxy)butanoic acid
This compound is primarily used in pharmaceutical research as a potential antioxidant and anti-inflammatory agent. It may also serve as a precursor in the synthesis of other bioactive molecules. In the cosmetic industry, it is valued for its stability and ability to enhance product efficacy. Industrial applications include use as a chemical intermediate, while its unique structure makes it relevant in studies related to lipid metabolism and organic chemistry.

About

CAS No 4345-03-3
English Name 4-Oxo-4-({(2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydro-2H-chromen-6-yl}oxy)butanoic acid
Molecular Formula C33H54O5
Molecular Weight 530.79 g/mol
SMILES CC(C)CCC[C@@H](C)CCC[C@@H](C)CCC[C@]1(C)CCc2c(C)c(OC(=O)CCC(=O)O)c(C)c(C)c2O1
InChIKey IELOKBJPULMYRW-NJQVLOCASA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What is 4-Oxo-4-({(2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydro-2H-chromen-6-yl}oxy)butanoic acid (CAS: 4345-03-3)?

4-Oxo-4-({(2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydro-2H-chromen-6-yl}...

Compound Q&A

Is 4-Oxo-4-({(2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydro-2H-chromen-6-yl}oxy)butanoic acid (CAS: 4345-03-3) safe?

The safety of this compound depends on its application and exposure levels. It is generally consider...

Compound Q&A

How should 4-Oxo-4-({(2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydro-2H-chromen-6-yl}oxy)butanoic acid (CAS: 4345-03-3) be stored?

This compound should be stored in a cool, dry, and dark place, ideally at 2-8°C, to maintain stabili...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...