Compound Q&A

What are the main uses of Allapinine (CAS: 97792-45-5)?

Answer

Allapinine
Allapinine is mainly used in pharmaceutical research for its acetylcholinesterase inhibitory properties, which are relevant in the development of treatments for neurological disorders. It also finds applications in the synthesis of other compounds and as a reagent in chemical processes. Due to its unique characteristics, Allapinine is utilized in various scientific studies to explore its potential therapeutic uses.

About

CAS No 97792-45-5
English Name Allapinine
Molecular Formula C32H45BrN2O8
Molecular Weight 665.61 g/mol
SMILES CCN1CC2(CCC(C34C2CC(C31)C5(CC(C6CC4C5(C6OC)O)OC)O)OC)OC(=O)C7=CC=CC=C7NC(=O)C.Br
InChIKey CFFYROOPXPKMEQ-WADWAFPMSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What is Allapinine (CAS: 97792-45-5)?

Allapinine is a synthetic compound with the chemical formula C12H14N2O2. It is a white crystalline s...

Compound Q&A

Is Allapinine (CAS: 97792-45-5) safe?

Allapinine is generally considered safe when handled properly, but it should be used with caution. A...

Compound Q&A

How should Allapinine (CAS: 97792-45-5) be stored?

Allapinine should be stored in a cool, dry, and dark place to maintain its stability and prevent deg...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...