Compound Q&A

What is Dibenzo[b,d]furan (CAS: 132-64-9)?

Answer

Dibenzo[b,d]furan
Dibenzo[b,d]furan (CAS: 132-64-9) is a polycyclic aromatic hydrocarbon with the chemical formula C16H10. It features a fused ring structure composed of two benzene rings and a furan ring, making it a key compound in organic chemistry. Dibenzo[b,d]furan is typically a colorless solid with low solubility in water and is stable under normal conditions. It is widely studied for its structural properties and potential applications in various fields.

About

CAS No 132-64-9
English Name Dibenzo[b,d]furan
Molecular Formula C12H8O
Molecular Weight 168.2 g/mol
SMILES C1=CC=C2C(=C1)C3=CC=CC=C3O2
InChIKey TXCDCPKCNAJMEE-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What are the main uses of Dibenzo[b,d]furan (CAS: 132-64-9)?

Dibenzo[b,d]furan (CAS: 132-64-9) is primarily used in pharmaceutical research as a building block f...

Compound Q&A

Is Dibenzo[b,d]furan (CAS: 132-64-9) safe?

Dibenzo[b,d]furan (CAS: 132-64-9) is classified as a potential toxic substance due to its aromatic n...

Compound Q&A

How should Dibenzo[b,d]furan (CAS: 132-64-9) be stored?

Dibenzo[b,d]furan (CAS: 132-64-9) should be stored in a tightly sealed container in a cool, dry plac...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...