Compound Q&A

What is 2-[(1E)-N-{[(2E)-3-Chloro-2-propen-1-yl]oxy}propanimidoyl]-5-[2-(ethylsulfanyl)propyl]-3-hydroxy-2-cyclohexen-1-one (CAS: 99129-21-2)?

Answer

2-[(1E)-N-{[(2E)-3-Chloro-2-propen-1-yl]oxy}propanimidoyl]-5-[2-(ethylsulfanyl)propyl]-3-hydroxy-2-cyclohexen-1-one
2-[(1E)-N-{[(2E)-3-Chloro-2-propen-1-yl]oxy}propanimidoyl]-5-[2-(ethylsulfanyl)propyl]-3-hydroxy-2-cyclohexen-1-one (CAS: 99129-21-2) is a complex organic compound characterized by its cyclohexenone ring, chloro-substituted alkene group, and sulfanyl-containing side chain. It exhibits functional groups such as hydroxyl, imidoyl, and ethylsulfanyl, making it relevant in organic synthesis and specialized chemical applications. Its exact molecular formula and physical properties require reference to chemical databases or supplier materials.

About

CAS No 99129-21-2
English Name 2-[(1E)-N-{[(2E)-3-Chloro-2-propen-1-yl]oxy}propanimidoyl]-5-[2-(ethylsulfanyl)propyl]-3-hydroxy-2-cyclohexen-1-one
Molecular Formula C17H26ClNO3S
Molecular Weight 359.92 g/mol
SMILES Cl/C=C/CON=C(C1=C(O)CC(CC1=O)CC(SCC)C)CC
InChIKey SILSDTWXNBZOGF-JWGBMQLESA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What are the main uses of 2-[(1E)-N-{[(2E)-3-Chloro-2-propen-1-yl]oxy}propanimidoyl]-5-[2-(ethylsulfanyl)propyl]-3-hydroxy-2-cyclohexen-1-one (CAS: 99129-21-2)?

This compound is primarily used in pharmaceutical research and industrial organic synthesis due to i...

Compound Q&A

Is 2-[(1E)-N-{[(2E)-3-Chloro-2-propen-1-yl]oxy}propanimidoyl]-5-[2-(ethylsulfanyl)propyl]-3-hydroxy-2-cyclohexen-1-one (CAS: 99129-21-2) safe?

Safety information for this compound is not widely documented. However, due to its chloro and sulfan...

Compound Q&A

How should 2-[(1E)-N-{[(2E)-3-Chloro-2-propen-1-yl]oxy}propanimidoyl]-5-[2-(ethylsulfanyl)propyl]-3-hydroxy-2-cyclohexen-1-one (CAS: 99129-21-2) be stored?

Store this compound in a cool, dry, and dark environment to maintain stability. Use airtight contain...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...