Compound Q&A

What is (3beta)-Lanosta-8,24-dien-3-ol (CAS: 79-63-0)?

Answer

(3beta)-Lanosta-8,24-dien-3-ol
(3beta)-Lanosta-8,24-dien-3-ol, with CAS number 79-63-0, is a naturally occurring triterpenoid compound found in various plants. It is a sterol derivative with the chemical formula C28H48O2 and is known for its unique structural features, including a cyclohexane ring and a double bond at positions 8 and 24. This compound exhibits specific physical and chemical properties that make it valuable in multiple scientific applications.

About

CAS No 79-63-0
English Name (3beta)-Lanosta-8,24-dien-3-ol
Molecular Formula C30H50O
Molecular Weight 426.73 g/mol
SMILES CC(=CCC[C@H]([C@H]1CC[C@@]2([C@]1(C)CCC1=C2CC[C@@H]2[C@]1(C)CC[C@@H](C2(C)C)O)C)C)C
InChIKey CAHGCLMLTWQZNJ-BQNIITSRSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What are the main uses of (3beta)-Lanosta-8,24-dien-3-ol (CAS: 79-63-0)?

(3beta)-Lanosta-8,24-dien-3-ol, CAS 79-63-0, is primarily used in pharmaceutical research for its po...

Compound Q&A

Is (3beta)-Lanosta-8,24-dien-3-ol (CAS: 79-63-0) safe?

(3beta)-Lanosta-8,24-dien-3-ol, CAS 79-63-0, is generally considered safe when handled properly. It ...

Compound Q&A

How should (3beta)-Lanosta-8,24-dien-3-ol (CAS: 79-63-0) be stored?

(3beta)-Lanosta-8,24-dien-3-ol, CAS 79-63-0, should be stored in a cool, dry, and dark place to main...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...