Compound Q&A

What are the main uses of Ethyl 3-aminobenzoate methanesulfonate (1:1) (CAS: 886-86-2)?

Answer

Ethyl 3-aminobenzoate methanesulfonate (1:1)
Ethyl 3-aminobenzoate methanesulfonate (1:1) is primarily used in pharmaceuticals as an intermediate in the synthesis of drugs. It also finds applications in organic chemistry research, particularly in the development of new compounds. Additionally, it is used in the production of certain dyes and as a buffer in chemical processes due to its acidic properties.

About

CAS No 886-86-2
English Name Ethyl 3-aminobenzoate methanesulfonate (1:1)
Molecular Formula C10H15NO5S
Molecular Weight 261.3 g/mol
SMILES CCOC(=O)C1=CC(=CC=C1)N.CS(=O)(=O)O
InChIKey FQZJYWMRQDKBQN-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What is Ethyl 3-aminobenzoate methanesulfonate (1:1) (CAS: 886-86-2)?

Ethyl 3-aminobenzoate methanesulfonate (1:1) is a chemical compound with the CAS number 886-86-2. It...

Compound Q&A

Is Ethyl 3-aminobenzoate methanesulfonate (1:1) (CAS: 886-86-2) safe?

Ethyl 3-aminobenzoate methanesulfonate (1:1) is generally considered safe when handled properly. How...

Compound Q&A

How should Ethyl 3-aminobenzoate methanesulfonate (1:1) (CAS: 886-86-2) be stored?

Ethyl 3-aminobenzoate methanesulfonate (1:1) should be stored in a cool, dry place away from direct ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...