Compound Q&A

What is 2-(Trifluoromethyl)benzoic acid (CAS: 433-97-6)?

Answer

2-(Trifluoromethyl)benzoic acid
2-(Trifluoromethyl)benzoic acid (CAS: 433-97-6) is an organic compound with the chemical formula C8H6F3CO2H. It is a benzoic acid derivative featuring a trifluoromethyl group attached to the benzene ring. This compound is known for its strong acidity and is commonly used in chemical synthesis due to its stability and reactivity. It appears as a white crystalline solid and has a high melting point, making it suitable for various industrial and research applications.

About

CAS No 433-97-6
English Name 2-(Trifluoromethyl)benzoic acid
Molecular Formula C8H5F3O2
Molecular Weight 190.12 g/mol
SMILES C1=CC=C(C(=C1)C(=O)O)C(F)(F)F
InChIKey FBRJYBGLCHWYOE-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What are the main uses of 2-(Trifluoromethyl)benzoic acid (CAS: 433-97-6)?

2-(Trifluoromethyl)benzoic acid (CAS: 433-97-6) is widely used in pharmaceutical research as an inte...

Compound Q&A

Is 2-(Trifluoromethyl)benzoic acid (CAS: 433-97-6) safe?

2-(Trifluoromethyl)benzoic acid (CAS: 433-97-6) is generally considered safe when handled properly. ...

Compound Q&A

How should 2-(Trifluoromethyl)benzoic acid (CAS: 433-97-6) be stored?

2-(Trifluoromethyl)benzoic acid (CAS: 433-97-6) should be stored in a cool, dry, and well-ventilated...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...