Compound Q&A

What is 1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-piperidinecarboxylic acid (CAS: 84358-12-3)?

Answer

1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-piperidinecarboxylic acid
1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-piperidinecarboxylic acid is a chemical compound with the CAS number 84358-12-3. It belongs to the class of piperidine derivatives and is characterized by its ester functional group. The compound is typically a white solid with a molecular formula of C12H23NO4 and exhibits moderate solubility in organic solvents. It is used as an intermediate in the synthesis of various pharmaceutical and chemical products.

About

CAS No 84358-12-3
English Name 1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-piperidinecarboxylic acid
Molecular Formula C11H19NO4
Molecular Weight 229.28 g/mol
SMILES CC(C)(C)OC(=O)N1CCCC(C1)C(=O)O
InChIKey NXILIHONWRXHFA-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What are the main uses of 1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-piperidinecarboxylic acid (CAS: 84358-12-3)?

1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-piperidinecarboxylic acid is primarily used in pharmaceutic...

Compound Q&A

Is 1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-piperidinecarboxylic acid (CAS: 84358-12-3) safe?

1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-piperidinecarboxylic acid is generally considered safe when...

Compound Q&A

How should 1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-piperidinecarboxylic acid (CAS: 84358-12-3) be stored?

This compound should be stored in a cool, dry, and well-ventilated place, away from light. It is bes...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...