Compound Q&A

What is (10-Phenyl-9-anthryl)boronic acid (CAS: 334658-75-2)?

Answer

(10-Phenyl-9-anthryl)boronic acid
(10-Phenyl-9-anthryl)boronic acid, with CAS number 334658-75-2, is an organic compound that contains a boronic acid group attached to an anthracene ring system. It is known for its aromatic structure and potential reactivity in chemical synthesis. The compound is typically used as a building block in the development of pharmaceuticals and materials due to its functional groups and structural versatility.

About

English Name (10-Phenyl-9-anthryl)boronic acid
Molecular Formula C20H15BO2
Molecular Weight 298.15 g/mol
SMILES B(C1=C2C=CC=CC2=C(C3=CC=CC=C13)C4=CC=CC=C4)(O)O
InChIKey RVPCPPWNSMAZKR-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What are the main uses of (10-Phenyl-9-anthryl)boronic acid (CAS: 334658-75-2)?

(10-Phenyl-9-anthryl)boronic acid (CAS: 334658-75-2) is widely used in pharmaceutical research for d...

Compound Q&A

Is (10-Phenyl-9-anthryl)boronic acid (CAS: 334658-75-2) safe?

(10-Phenyl-9-anthryl)boronic acid (CAS: 334658-75-2) is generally considered safe when handled prope...

Compound Q&A

How should (10-Phenyl-9-anthryl)boronic acid (CAS: 334658-75-2) be stored?

(10-Phenyl-9-anthryl)boronic acid (CAS: 334658-75-2) should be stored in a cool, dry, and dark place...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...