Compound Q&A

What are the main uses of 2-[(E)-(Hydroxyimino)methyl]-1-methylpyridinium chloride (CAS: 51-15-0)?

Answer

2-[(E)-(Hydroxyimino)methyl]-1-methylpyridinium chloride
2-[(E)-(Hydroxyimino)methyl]-1-methylpyridinium chloride (CAS: 51-15-0) is primarily used in pharmaceutical applications as an intermediate in the synthesis of various drugs. It also finds use in organic synthesis, chemical research, and as a reagent in analytical procedures. Its applications may include the development of antiviral and antibacterial agents due to its structural properties.

About

CAS No 51-15-0
English Name 2-[(E)-(Hydroxyimino)methyl]-1-methylpyridinium chloride
Molecular Formula C7H9ClN2O
Molecular Weight 172.61 g/mol
SMILES C[N+]1=CC=CC=C1C=NO.[Cl-]
InChIKey HIGSLXSBYYMVKI-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What is 2-[(E)-(Hydroxyimino)methyl]-1-methylpyridinium chloride (CAS: 51-15-0)?

2-[(E)-(Hydroxyimino)methyl]-1-methylpyridinium chloride (CAS: 51-15-0) is an organic compound with ...

Compound Q&A

Is 2-[(E)-(Hydroxyimino)methyl]-1-methylpyridinium chloride (CAS: 51-15-0) safe?

2-[(E)-(Hydroxyimino)methyl]-1-methylpyridinium chloride (CAS: 51-15-0) is generally considered safe...

Compound Q&A

How should 2-[(E)-(Hydroxyimino)methyl]-1-methylpyridinium chloride (CAS: 51-15-0) be stored?

2-[(E)-(Hydroxyimino)methyl]-1-methylpyridinium chloride (CAS: 51-15-0) should be stored in a cool, ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...