Compound Q&A

What is (1S,2R,6S,7S)-10-Methyl-4-oxatricyclo[5.2.1.0~2,6~]dec-8-ene-3,5-dione (CAS: 25134-21-8)?

Answer

(1S,2R,6S,7S)-10-Methyl-4-oxatricyclo[5.2.1.0~2,6~]dec-8-ene-3,5-dione
The compound (1S,2R,6S,7S)-10-Methyl-4-oxatricyclo[5.2.1.0~2,6~]dec-8-ene-3,5-dione (CAS: 25134-21-8) is a complex organic molecule characterized by a tricyclic ring system with an oxygen-containing heterocycle. It exhibits structural features typical of oxetanes and contains multiple functional groups including ketone and alkene moieties. This compound is often studied for its potential in medicinal chemistry due to its unique molecular framework.

About

CAS No 25134-21-8
English Name (1S,2R,6S,7S)-10-Methyl-4-oxatricyclo[5.2.1.0~2,6~]dec-8-ene-3,5-dione
Molecular Formula C10H10O3
Molecular Weight 178.19 g/mol
SMILES O=C1OC([C@]2(C)[C@](C3)([H])C=C[C@]3([H])[C@@]21[H])=O
InChIKey SBKPSHZVULRXED-ZXVYDBTHSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What are the main uses of (1S,2R,6S,7S)-10-Methyl-4-oxatricyclo[5.2.1.0~2,6~]dec-8-ene-3,5-dione (CAS: 25134-21-8)?

The compound (1S,2R,6S,7S)-10-Methyl-4-oxatricyclo[5.2.1.0~2,6~]dec-8-ene-3,5-dione (CAS: 25134-21-8...

Compound Q&A

Is (1S,2R,6S,7S)-10-Methyl-4-oxatricyclo[5.2.1.0~2,6~]dec-8-ene-3,5-dione (CAS: 25134-21-8) safe?

The safety of (1S,2R,6S,7S)-10-Methyl-4-oxatricyclo[5.2.1.0~2,6~]dec-8-ene-3,5-dione (CAS: 25134-21-...

Compound Q&A

How should (1S,2R,6S,7S)-10-Methyl-4-oxatricyclo[5.2.1.0~2,6~]dec-8-ene-3,5-dione (CAS: 25134-21-8) be stored?

The compound (1S,2R,6S,7S)-10-Methyl-4-oxatricyclo[5.2.1.0~2,6~]dec-8-ene-3,5-dione (CAS: 25134-21-8...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...