Compound Q&A

What are the main uses of 4,5,6,7-Tetrabromo-2-benzofuran-1,3-dione (CAS: 632-79-1)?

Answer

4,5,6,7-Tetrabromo-2-benzofuran-1,3-dione
4,5,6,7-Tetrabromo-2-benzofuran-1,3-dione (CAS: 632-79-1) is primarily used in the pharmaceutical industry as an intermediate in the synthesis of various drugs. It also finds applications in organic chemistry research, where its unique structure makes it useful for creating complex molecules. Additionally, it is employed in the production of dyes, agrochemicals, and other specialty chemicals due to its brominated nature and chemical reactivity.

About

CAS No 632-79-1
English Name 4,5,6,7-Tetrabromo-2-benzofuran-1,3-dione
Molecular Formula C8Br4O3
Molecular Weight 463.7 g/mol
SMILES C12=C(C(=C(C(=C1Br)Br)Br)Br)C(=O)OC2=O
InChIKey QHWKHLYUUZGSCW-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What is 4,5,6,7-Tetrabromo-2-benzofuran-1,3-dione (CAS: 632-79-1)?

4,5,6,7-Tetrabromo-2-benzofuran-1,3-dione is an organic compound with the CAS number 632-79-1. It co...

Compound Q&A

Is 4,5,6,7-Tetrabromo-2-benzofuran-1,3-dione (CAS: 632-79-1) safe?

4,5,6,7-Tetrabromo-2-benzofuran-1,3-dione (CAS: 632-79-1) requires careful handling due to potential...

Compound Q&A

How should 4,5,6,7-Tetrabromo-2-benzofuran-1,3-dione (CAS: 632-79-1) be stored?

4,5,6,7-Tetrabromo-2-benzofuran-1,3-dione (CAS: 632-79-1) should be stored in a cool, dry, and well-...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...