Compound Q&A

What is 4-Fluoro-2-methoxy-5-nitroaniline (CAS: 1075705-01-9)?

Answer

4-Fluoro-2-methoxy-5-nitroaniline
4-Fluoro-2-methoxy-5-nitroaniline is an organic compound with the chemical formula C7H7FN2O2. It is a substituted aniline containing fluorine, methoxy, and nitro groups. This compound is known for its aromatic structure and functional group diversity, which contribute to its reactivity and potential applications in chemical synthesis.

About

English Name 4-Fluoro-2-methoxy-5-nitroaniline
Molecular Formula C7H7FN2O3
Molecular Weight 186.14 g/mol
SMILES COC1=CC(=C(C=C1N)[N+](=O)[O-])F
InChIKey FYSIGSQCZXQTIH-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What are the main uses of 4-Fluoro-2-methoxy-5-nitroaniline (CAS: 1075705-01-9)?

4-Fluoro-2-methoxy-5-nitroaniline is primarily used in pharmaceutical research as a building block f...

Compound Q&A

Is 4-Fluoro-2-methoxy-5-nitroaniline (CAS: 1075705-01-9) safe?

4-Fluoro-2-methoxy-5-nitroaniline should be handled with care as it may have potential health and en...

Compound Q&A

How should 4-Fluoro-2-methoxy-5-nitroaniline (CAS: 1075705-01-9) be stored?

4-Fluoro-2-methoxy-5-nitroaniline should be stored in a cool, dry, and dark place, away from moistur...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...