Compound Q&A

What is 1,1'-(Oxydicarbonyl)di(2,3,4-perylenetricarboxylic acid) (CAS: 128-69-8)?

Answer

1,1'-(Oxydicarbonyl)di(2,3,4-perylenetricarboxylic acid)
1,1'-(Oxydicarbonyl)di(2,3,4-perylenetricarboxylic acid), with the CAS number 128-69-8, is a synthetic organic compound that belongs to the class of perylene derivatives. It is characterized by its complex molecular structure, containing two perylenetricarboxylic acid units linked by an oxydicarbonyl bridge. This compound is known for its high molecular weight and potential applications in advanced materials and chemical research due to its unique optical and electronic properties.

About

CAS No 128-69-8
English Name 1,1'-(Oxydicarbonyl)di(2,3,4-perylenetricarboxylic acid)
Molecular Formula C48H22O15
Molecular Weight 838.69 g/mol
SMILES c1cc2cccc3c2c(c1)c4ccc(c5c4c3c(c(c5C(=O)O)C(=O)O)C(=O)OC(=O)c6c7c8cccc9c8c(ccc9)c1c7c(c(cc1)C(=O)O)c(c6C(=O)O)C(=O)O)C(=O)O
InChIKey BVTFXNVEBOOFNJ-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What are the main uses of 1,1'-(Oxydicarbonyl)di(2,3,4-perylenetricarboxylic acid) (CAS: 128-69-8)?

1,1'-(Oxydicarbonyl)di(2,3,4-perylenetricarboxylic acid) is primarily used in the development of org...

Compound Q&A

Is 1,1'-(Oxydicarbonyl)di(2,3,4-perylenetricarboxylic acid) (CAS: 128-69-8) safe?

1,1'-(Oxydicarbonyl)di(2,3,4-perylenetricarboxylic acid) is generally considered safe when handled p...

Compound Q&A

How should 1,1'-(Oxydicarbonyl)di(2,3,4-perylenetricarboxylic acid) (CAS: 128-69-8) be stored?

This compound should be stored in a cool, dry, and well-ventilated area, away from direct light. It ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...