Compound Q&A

What is 2-Methyl-5-nitro-1H-isoindole-1,3(2H)-dione (CAS: 41663-84-7)?

Answer

2-Methyl-5-nitro-1H-isoindole-1,3(2H)-dione
2-Methyl-5-nitro-1H-isoindole-1,3(2H)-dione (CAS: 41663-84-7) is a heterocyclic compound with the molecular formula C8H6N2O4. It features a fused benzene ring and a pyrrole ring, with substituents including a methyl group and nitro groups. This compound is typically a solid with strong polarity, making it soluble in polar solvents. Its chemical structure and functional groups suggest potential applications in organic synthesis and pharmaceutical research.

About

CAS No 41663-84-7
English Name 2-Methyl-5-nitro-1H-isoindole-1,3(2H)-dione
Molecular Formula C9H6N2O4
Molecular Weight 206.15 g/mol
SMILES CN1C(=O)C2=C(C1=O)C=C(C=C2)[N+](=O)[O-]
InChIKey JBCHWGTZAAZJKG-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What are the main uses of 2-Methyl-5-nitro-1H-isoindole-1,3(2H)-dione (CAS: 41663-84-7)?

2-Methyl-5-nitro-1H-isoindole-1,3(2H)-dione (CAS: 41663-84-7) is primarily used as a synthetic inter...

Compound Q&A

Is 2-Methyl-5-nitro-1H-isoindole-1,3(2H)-dione (CAS: 41663-84-7) safe?

2-Methyl-5-nitro-1H-isoindole-1,3(2H)-dione (CAS: 41663-84-7) requires careful handling due to its p...

Compound Q&A

How should 2-Methyl-5-nitro-1H-isoindole-1,3(2H)-dione (CAS: 41663-84-7) be stored?

2-Methyl-5-nitro-1H-isoindole-1,3(2H)-dione (CAS: 41663-84-7) should be stored in a sealed, airtight...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...