Compound Q&A

What are the main uses of 3-Hydroxy-2,2,4-trimethylpentyl 2-methylpropanoate (CAS: 25265-77-4)?

Answer

3-Hydroxy-2,2,4-trimethylpentyl 2-methylpropanoate
This compound is primarily used in pharmaceutical research as a synthetic intermediate, in the fragrance and flavor industry for its aromatic properties, and in organic chemistry studies for structural analysis. It also serves as a solvent in specific industrial processes and is utilized in the development of specialty polymers and coatings.

About

CAS No 25265-77-4
English Name 3-Hydroxy-2,2,4-trimethylpentyl 2-methylpropanoate
Molecular Formula C12H24O3
Molecular Weight 216.32 g/mol
SMILES CC(C)C(C(C)(C)COC(=O)C(C)C)O
InChIKey DAFHKNAQFPVRKR-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What is 3-Hydroxy-2,2,4-trimethylpentyl 2-methylpropanoate (CAS: 25265-77-4)?

3-Hydroxy-2,2,4-trimethylpentyl 2-methylpropanoate (CAS: 25265-77-4) is an ester compound with the c...

Compound Q&A

Is 3-Hydroxy-2,2,4-trimethylpentyl 2-methylpropanoate (CAS: 25265-77-4) safe?

3-Hydroxy-2,2,4-trimethylpentyl 2-methylpropanoate (CAS: 25265-77-4) is generally considered safe wh...

Compound Q&A

How should 3-Hydroxy-2,2,4-trimethylpentyl 2-methylpropanoate (CAS: 25265-77-4) be stored?

Store 3-Hydroxy-2,2,4-trimethylpentyl 2-methylpropanoate (CAS: 25265-77-4) in a sealed, airtight con...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...