Compound Q&A

What are the main uses of Dioctyl sebacate (CAS: 2432-87-3)?

Answer

Dioctyl sebacate
Dioctyl sebacate (CAS: 2432-87-3) is widely used in the manufacturing of rubber, plastics, and coatings. It serves as a plasticizer in various industries including pharmaceuticals, food packaging, and research. It is also used in the production of medical devices and adhesives due to its compatibility with different materials.

About

CAS No 2432-87-3
English Name Dioctyl sebacate
Molecular Formula C26H50O4
Molecular Weight 426.68 g/mol
SMILES CCCCCCCCOC(=O)CCCCCCCCC(=O)OCCCCCCCC
InChIKey MIMDHDXOBDPUQW-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What is Dioctyl sebacate (CAS: 2432-87-3)?

Dioctyl sebacate (CAS: 2432-87-3) is a chemical compound used as a plasticizer. Its chemical formula...

Compound Q&A

Is Dioctyl sebacate (CAS: 2432-87-3) safe?

Dioctyl sebacate (CAS: 2432-87-3) is generally considered safe when used as directed. However, it sh...

Compound Q&A

How should Dioctyl sebacate (CAS: 2432-87-3) be stored?

Dioctyl sebacate (CAS: 2432-87-3) should be stored in a cool, dry, and well-ventilated area away fro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...