Compound Q&A

What is 1,1,1-Trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (CAS: 82113-65-3)?

Answer

1,1,1-Trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide
1,1,1-Trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (CAS: 82113-65-3) is an organic compound containing fluorine and sulfur atoms. Its chemical formula is C2F7NO2S, and it is characterized by its high fluorine content and amide functional group. This compound is typically used in specialized chemical applications due to its unique reactivity and stability properties.

About

CAS No 82113-65-3
English Name 1,1,1-Trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide
Molecular Formula C2HF6NO4S2
Molecular Weight 281.16 g/mol
SMILES C(F)(F)(F)S(=O)(=O)NS(=O)(=O)C(F)(F)F
InChIKey ZXMGHDIOOHOAAE-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What are the main uses of 1,1,1-Trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (CAS: 82113-65-3)?

1,1,1-Trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (CAS: 82113-65-3) is primarily used ...

Compound Q&A

Is 1,1,1-Trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (CAS: 82113-65-3) safe?

1,1,1-Trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (CAS: 82113-65-3) is generally consi...

Compound Q&A

How should 1,1,1-Trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (CAS: 82113-65-3) be stored?

1,1,1-Trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (CAS: 82113-65-3) should be stored i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...