Compound Q&A

What is N,N-Diethyl-1,4-benzenediamine sulfate (1:1) (CAS: 6283-63-2)?

Answer

N,N-Diethyl-1,4-benzenediamine sulfate (1:1)
N,N-Diethyl-1,4-benzenediamine sulfate (1:1) is a chemical compound with the CAS number 6283-63-2. It consists of a benzene ring with amino groups at positions 1 and 4, substituted with ethyl groups, and combined with a sulfate ion in a 1:1 ratio. This compound is typically a white crystalline solid, soluble in water, and used as an intermediate in various chemical processes. Its molecular formula is C10H16N2O4S.

About

CAS No 6283-63-2
English Name N,N-Diethyl-1,4-benzenediamine sulfate (1:1)
Molecular Formula C10H18N2O4S
Molecular Weight 262.33 g/mol
SMILES CCN(CC)c1ccc(N)cc1.OS(=O)(=O)O
InChIKey AYLDJQABCMPYEN-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What are the main uses of N,N-Diethyl-1,4-benzenediamine sulfate (1:1) (CAS: 6283-63-2)?

N,N-Diethyl-1,4-benzenediamine sulfate (1:1) (CAS: 6283-63-2) is primarily used in the pharmaceutica...

Compound Q&A

Is N,N-Diethyl-1,4-benzenediamine sulfate (1:1) (CAS: 6283-63-2) safe?

N,N-Diethyl-1,4-benzenediamine sulfate (1:1) (CAS: 6283-63-2) is generally considered safe when hand...

Compound Q&A

How should N,N-Diethyl-1,4-benzenediamine sulfate (1:1) (CAS: 6283-63-2) be stored?

N,N-Diethyl-1,4-benzenediamine sulfate (1:1) (CAS: 6283-63-2) should be stored in a cool, dry place,...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...