Compound Q&A

What are the main uses of 2-Cyanoethyl N,N,N',N'-tetraisopropylphosphorodiamidoite (CAS: 102691-36-1)?

Answer

2-Cyanoethyl N,N,N',N'-tetraisopropylphosphorodiamidoite
This compound is widely used in pharmaceutical research as a coupling agent and intermediate for drug development. It also finds applications in industrial chemistry for synthesizing functional materials and electronic compounds. In research settings, it serves as a building block for creating complex molecules, including those with phosphorus-based functionalities. Its unique structure makes it valuable in organic synthesis and materials science.

About

English Name 2-Cyanoethyl N,N,N',N'-tetraisopropylphosphorodiamidoite
Molecular Formula C15H32N3OP
Molecular Weight 301.41 g/mol
SMILES CC(C)N(C(C)C)P(N(C(C)C)C(C)C)OCCC#N
InChIKey RKVHNYJPIXOHRW-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What is 2-Cyanoethyl N,N,N',N'-tetraisopropylphosphorodiamidoite (CAS: 102691-36-1)?

2-Cyanoethyl N,N,N',N'-tetraisopropylphosphorodiamidoite (CAS: 102691-36-1) is an organophosphorus c...

Compound Q&A

Is 2-Cyanoethyl N,N,N',N'-tetraisopropylphosphorodiamidoite (CAS: 102691-36-1) safe?

2-Cyanoethyl N,N,N',N'-tetraisopropylphosphorodiamidoite (CAS: 102691-36-1) is generally considered ...

Compound Q&A

How should 2-Cyanoethyl N,N,N',N'-tetraisopropylphosphorodiamidoite (CAS: 102691-36-1) be stored?

Store 2-Cyanoethyl N,N,N',N'-tetraisopropylphosphorodiamidoite (CAS: 102691-36-1) in a cool, dry, an...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...