Compound Q&A

What is 3-Bromo-9-phenyl-9H-carbazole (CAS: 1153-85-1)?

Answer

3-Bromo-9-phenyl-9H-carbazole
3-Bromo-9-phenyl-9H-carbazole (CAS: 1153-85-1) is an organic compound with the chemical formula C18H13Br. It features a fused benzene-indole ring system, with a bromine atom at the 3-position and a phenyl group attached to the 9-position. This compound is known for its aromatic characteristics and is commonly used in synthetic chemistry for structural modifications. Its physical properties include a solid state at room temperature and low solubility in water, making it suitable for specific chemical applications.

About

CAS No 1153-85-1
English Name 3-Bromo-9-phenyl-9H-carbazole
Molecular Formula C18H12BrN
Molecular Weight 322.21 g/mol
SMILES C1=CC=C(C=C1)N2C3=C(C=C(C=C3)Br)C4=CC=CC=C42
InChIKey KUBSCXXKQGDPPD-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What are the main uses of 3-Bromo-9-phenyl-9H-carbazole (CAS: 1153-85-1)?

3-Bromo-9-phenyl-9H-carbazole (CAS: 1153-85-1) is primarily utilized in pharmaceutical research as a...

Compound Q&A

Is 3-Bromo-9-phenyl-9H-carbazole (CAS: 1153-85-1) safe?

3-Bromo-9-phenyl-9H-carbazole (CAS: 1153-85-1) requires careful handling due to its potential toxici...

Compound Q&A

How should 3-Bromo-9-phenyl-9H-carbazole (CAS: 1153-85-1) be stored?

3-Bromo-9-phenyl-9H-carbazole (CAS: 1153-85-1) should be stored in a cool, dry place at temperatures...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...