Compound Q&A

What are the main uses of 4-amino-3-phenylbutanoic acid (CAS: 1078-21-3)?

Answer

4-amino-3-phenylbutanoic acid
4-Amino-3-phenylbutanoic acid (CAS: 1078-21-3) is primarily used in pharmaceutical research as a precursor for drug development. It also finds applications in the synthesis of various organic compounds, including pharmaceutical intermediates and specialty chemicals. Its unique structure makes it valuable in the creation of bioactive molecules and functional materials.

About

CAS No 1078-21-3
English Name 4-amino-3-phenylbutanoic acid
Molecular Formula C10H13NO2
Molecular Weight 179.22 g/mol
EINECS 214-079-6
SMILES C1=CC=C(C=C1)C(CC(=O)O)CN
InChIKey DAFOCGYVTAOKAJ-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What is 4-amino-3-phenylbutanoic acid (CAS: 1078-21-3)?

4-Amino-3-phenylbutanoic acid (CAS: 1078-21-3) is an organic compound with the chemical formula C10H...

Compound Q&A

Is 4-amino-3-phenylbutanoic acid (CAS: 1078-21-3) safe?

4-Amino-3-phenylbutanoic acid (CAS: 1078-21-3) is generally considered safe when handled properly. H...

Compound Q&A

How should 4-amino-3-phenylbutanoic acid (CAS: 1078-21-3) be stored?

4-Amino-3-phenylbutanoic acid (CAS: 1078-21-3) should be stored in a cool, dry, and well-ventilated ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...