Compound Q&A

How should Deacetyltaxol (CAS: 78432-77-6) be stored?

Answer

Deacetyltaxol
Deacetyltaxol should be stored in a cool, dry place away from direct light. It is typically kept in airtight containers at a temperature of 2-8°C to maintain stability. Proper storage conditions are essential to prevent degradation and ensure the compound remains effective for research or pharmaceutical use.

About

CAS No 78432-77-6
English Name Deacetyltaxol
Molecular Formula C45H49NO13
Molecular Weight 811.88 g/mol
SMILES CC(=O)O[C@@]12CO[C@@H]1C[C@@H]([C@@]1([C@@H]2[C@H](OC(=O)c2ccccc2)[C@]2(O)C[C@H](OC(=O)[C@@H]([C@H](c3ccccc3)NC(=O)c3ccccc3)O)C(=C(C2(C)C)[C@H](C1=O)O)C)C)O
InChIKey TYLVGQKNNUHXIP-MHHARFCSSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What is Deacetyltaxol (CAS: 78432-77-6)?

Deacetyltaxol is a natural organic compound derived from the Pacific yew tree (Taxus brevifolia). It...

Compound Q&A

What are the main uses of Deacetyltaxol (CAS: 78432-77-6)?

Deacetyltaxol is primarily used in pharmaceutical research and development as a potential anticancer...

Compound Q&A

Is Deacetyltaxol (CAS: 78432-77-6) safe?

Deacetyltaxol is generally considered safe when handled properly in controlled environments. However...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...