Compound Q&A

What is N~2~-{[(2-Methyl-2-propanyl)oxy]carbonyl}-L-glutamine (CAS: 13726-85-7)?

Answer

N~2~-{[(2-Methyl-2-propanyl)oxy]carbonyl}-L-glutamine
N~2~-{[(2-Methyl-2-propanyl)oxy]carbonyl}-L-glutamine, with the CAS number 13726-85-7, is a derivative of L-glutamine. It contains a tert-butyl group connected through an ester linkage to the glutamine molecule, making it a protected amino acid. This compound is commonly used in organic synthesis and biochemical research due to its stability and reactivity. It has a molecular formula of C10H19NO5 and exhibits typical properties of amino acid derivatives, such as solubility in polar solvents and reactivity in nucleophilic substitution reactions.

About

CAS No 13726-85-7
English Name N~2~-{[(2-Methyl-2-propanyl)oxy]carbonyl}-L-glutamine
Molecular Formula C10H18N2O5
Molecular Weight 246.26 g/mol
SMILES CC(C)(C)OC(=O)NC(CCC(=O)N)C(=O)O
InChIKey VVNYDCGZZSTUBC-LURJTMIESA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What are the main uses of N~2~-{[(2-Methyl-2-propanyl)oxy]carbonyl}-L-glutamine (CAS: 13726-85-7)?

N~2~-{[(2-Methyl-2-propanyl)oxy]carbonyl}-L-glutamine is primarily used in pharmaceutical research a...

Compound Q&A

Is N~2~-{[(2-Methyl-2-propanyl)oxy]carbonyl}-L-glutamine (CAS: 13726-85-7) safe?

N~2~-{[(2-Methyl-2-propanyl)oxy]carbonyl}-L-glutamine is generally considered safe when handled prop...

Compound Q&A

How should N~2~-{[(2-Methyl-2-propanyl)oxy]carbonyl}-L-glutamine (CAS: 13726-85-7) be stored?

N~2~-{[(2-Methyl-2-propanyl)oxy]carbonyl}-L-glutamine should be stored in a cool, dry place away fro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...