Compound Q&A

What is 1,2,3,4,6-Penta-O-acetyl-alpha-D-glucopyranose (CAS: 604-68-2)?

Answer

1,2,3,4,6-Penta-O-acetyl-alpha-D-glucopyranose
1,2,3,4,6-Penta-O-acetyl-alpha-D-glucopyranose is a fully acetylated derivative of glucose, commonly used as a protecting group in organic synthesis. Its chemical formula is C14H22O11, and it is a white crystalline solid with high solubility in organic solvents. This compound is known for its stability and is often employed in carbohydrate chemistry to prevent unwanted reactions during synthesis or analysis.

About

CAS No 604-68-2
English Name 1,2,3,4,6-Penta-O-acetyl-alpha-D-glucopyranose
Molecular Formula C16H22O11
Molecular Weight 390.34 g/mol
SMILES CC(=O)OC[C@H]1O[C@H](OC(=O)C)[C@H](OC(=O)C)[C@@H](OC(=O)C)[C@@H]1OC(=O)C
InChIKey LPTITAGPBXDDGR-LJIZCISZSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What are the main uses of 1,2,3,4,6-Penta-O-acetyl-alpha-D-glucopyranose (CAS: 604-68-2)?

This compound is primarily used in pharmaceutical research for the synthesis of glycosides and other...

Compound Q&A

Is 1,2,3,4,6-Penta-O-acetyl-alpha-D-glucopyranose (CAS: 604-68-2) safe?

1,2,3,4,6-Penta-O-acetyl-alpha-D-glucopyranose is generally considered safe when handled properly. I...

Compound Q&A

How should 1,2,3,4,6-Penta-O-acetyl-alpha-D-glucopyranose (CAS: 604-68-2) be stored?

This compound should be stored in a cool, dry place away from direct light. It is best kept in a sea...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...