Compound Q&A

What are the main uses of 2,5-Dichloro-N-[2-(isopropylsulfonyl)phenyl]-4-pyrimidinamine (CAS: 761440-16-8)?

Answer

2,5-Dichloro-N-[2-(isopropylsulfonyl)phenyl]-4-pyrimidinamine
This compound is primarily used in pharmaceutical research as a building block for developing drugs targeting various biological processes. It also finds applications in the synthesis of agrochemicals and organic materials. Its unique chemical structure makes it valuable in the design of molecules with specific functional properties, such as antimicrobial or antiviral agents.

About

English Name 2,5-Dichloro-N-[2-(isopropylsulfonyl)phenyl]-4-pyrimidinamine
Molecular Formula C13H13Cl2N3O2S
Molecular Weight 346.23900000000003 g/mol
SMILES CC(C)S(=O)(=O)C1=CC=CC=C1NC2=NC(=NC=C2Cl)Cl
InChIKey WWVLDJAVSQZSKO-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What is 2,5-Dichloro-N-[2-(isopropylsulfonyl)phenyl]-4-pyrimidinamine (CAS: 761440-16-8)?

2,5-Dichloro-N-[2-(isopropylsulfonyl)phenyl]-4-pyrimidinamine (CAS: 761440-16-8) is a synthetic orga...

Compound Q&A

Is 2,5-Dichloro-N-[2-(isopropylsulfonyl)phenyl]-4-pyrimidinamine (CAS: 761440-16-8) safe?

2,5-Dichloro-N-[2-(isopropylsulfonyl)phenyl]-4-pyrimidinamine (CAS: 761440-16-8) should be handled w...

Compound Q&A

How should 2,5-Dichloro-N-[2-(isopropylsulfonyl)phenyl]-4-pyrimidinamine (CAS: 761440-16-8) be stored?

This compound should be stored in a cool, dry, and dark place, ideally at 2-8°C, to maintain its sta...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...