Compound Q&A

What is 1-Pyrrolidinecarbodithioic acid ammoniate (1:1) (CAS: 5108-96-3)?

Answer

1-Pyrrolidinecarbodithioic acid ammoniate (1:1)
1-Pyrrolidinecarbodithioic acid ammoniate (1:1), with CAS number 5108-96-3, is a sulfur-containing organic compound featuring a pyrrolidine ring linked to a carbodithioic acid group. It exists as a 1:1 ammonium salt and is known for its reactivity in chemical synthesis. The compound is typically a solid at room temperature and has applications in various industries due to its unique functional groups and structural properties.

About

CAS No 5108-96-3
English Name 1-Pyrrolidinecarbodithioic acid ammoniate (1:1)
Molecular Formula C5H12N2S2
Molecular Weight 164.3 g/mol
SMILES C1CCN(C1)C(=S)[S-].[NH4+]
InChIKey MDDIUTVUBYEEEM-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What are the main uses of 1-Pyrrolidinecarbodithioic acid ammoniate (1:1) (CAS: 5108-96-3)?

1-Pyrrolidinecarbodithioic acid ammoniate (1:1) (CAS: 5108-96-3) is primarily used in pharmaceutical...

Compound Q&A

Is 1-Pyrrolidinecarbodithioic acid ammoniate (1:1) (CAS: 5108-96-3) safe?

1-Pyrrolidinecarbodithioic acid ammoniate (1:1) (CAS: 5108-96-3) requires careful handling due to po...

Compound Q&A

How should 1-Pyrrolidinecarbodithioic acid ammoniate (1:1) (CAS: 5108-96-3) be stored?

Store 1-Pyrrolidinecarbodithioic acid ammoniate (1:1) (CAS: 5108-96-3) in a cool, dry, and dark plac...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...