Compound Q&A

What are the main uses of sulfuric acid, triaminopyrimidin-4-ol (CAS: 35011-47-3)?

Answer

sulfuric acid, triaminopyrimidin-4-ol
Sulfuric acid, triaminopyrimidin-4-ol (CAS: 35011-47-3) is primarily used in pharmaceutical research for the synthesis of various drugs, particularly those targeting antimicrobial and antiviral applications. It also finds use in industrial chemical processes and as a precursor in the development of organic compounds.

About

CAS No 35011-47-3
English Name sulfuric acid, triaminopyrimidin-4-ol
Molecular Formula C4H9N5O5S
Molecular Weight 239.213 g/mol
SMILES Nc1nc(N)c(N)c(O)n1.OS(=O)(=O)O
InChIKey RSKNEEODWFLVFF-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What is sulfuric acid, triaminopyrimidin-4-ol (CAS: 35011-47-3)?

Sulfuric acid, triaminopyrimidin-4-ol (CAS: 35011-47-3) is a chemical compound that contains a pyrim...

Compound Q&A

Is sulfuric acid, triaminopyrimidin-4-ol (CAS: 35011-47-3) safe?

Sulfuric acid, triaminopyrimidin-4-ol (CAS: 35011-47-3) requires careful handling due to its corrosi...

Compound Q&A

How should sulfuric acid, triaminopyrimidin-4-ol (CAS: 35011-47-3) be stored?

Sulfuric acid, triaminopyrimidin-4-ol (CAS: 35011-47-3) should be stored in a cool, dry, and well-ve...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...