Compound Q&A

What is 3,4-Dimethoxycinnamic acid (CAS: 2316-26-9)?

Answer

3,4-Dimethoxycinnamic acid
3,4-Dimethoxycinnamic acid (CAS: 2316-26-9) is an organic compound with the chemical formula C13H12O5. It is a derivative of cinnamic acid, featuring methoxy groups at the 3 and 4 positions. This compound is known for its aromatic structure and is commonly used in various scientific and industrial applications due to its stability and reactivity.

About

CAS No 2316-26-9
English Name 3,4-Dimethoxycinnamic acid
Molecular Formula C11H12O4
Molecular Weight 208.21 g/mol
SMILES O=C(O)/C=C/C1=CC=C(OC)C(OC)=C1
InChIKey HJBWJAPEBGSQPR-GQCTYLIASA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What are the main uses of 3,4-Dimethoxycinnamic acid (CAS: 2316-26-9)?

3,4-Dimethoxycinnamic acid (CAS: 2316-26-9) is used in pharmaceutical research as a potential antiox...

Compound Q&A

Is 3,4-Dimethoxycinnamic acid (CAS: 2316-26-9) safe?

3,4-Dimethoxycinnamic acid (CAS: 2316-26-9) is generally considered safe when handled properly. Howe...

Compound Q&A

How should 3,4-Dimethoxycinnamic acid (CAS: 2316-26-9) be stored?

3,4-Dimethoxycinnamic acid (CAS: 2316-26-9) should be stored in a cool, dry, and dark place to maint...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...