Compound Q&A

What is 2-Methyl-6-methylene-7-octen-2-yl acetate (CAS: 8006-64-2)?

Answer

2-Methyl-6-methylene-7-octen-2-yl acetate
2-Methyl-6-methylene-7-octen-2-yl acetate is an organic compound with the CAS number 8006-64-2. It belongs to the family of esters and is characterized by a long hydrocarbon chain with multiple double bonds and a methyl group. This compound is often used in synthetic chemistry due to its reactivity and structural versatility. It is a colorless liquid with a mild odor and is relatively stable under normal conditions.

About

CAS No 8006-64-2
English Name 2-Methyl-6-methylene-7-octen-2-yl acetate
Molecular Formula C12H20O2
Molecular Weight 196.29 g/mol
EINECS 932-349-8
SMILES CC(=O)OC(C)(C)CCCC(=C)C=C
InChIKey DCXXKSXLKWAZNO-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What are the main uses of 2-Methyl-6-methylene-7-octen-2-yl acetate (CAS: 8006-64-2)?

2-Methyl-6-methylene-7-octen-2-yl acetate is primarily used in the synthesis of various organic comp...

Compound Q&A

Is 2-Methyl-6-methylene-7-octen-2-yl acetate (CAS: 8006-64-2) safe?

2-Methyl-6-methylene-7-octen-2-yl acetate is generally considered safe when handled properly, but it...

Compound Q&A

How should 2-Methyl-6-methylene-7-octen-2-yl acetate (CAS: 8006-64-2) be stored?

2-Methyl-6-methylene-7-octen-2-yl acetate should be stored in a cool, dry, and well-ventilated area,...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...