Compound Q&A

What is 4-Nitrobenzyl 2-diazo-3-oxobutanoate (CAS: 82551-63-1)?

Answer

4-Nitrobenzyl 2-diazo-3-oxobutanoate
4-Nitrobenzyl 2-diazo-3-oxobutanoate (CAS: 82551-63-1) is an organic compound characterized by a nitro group and a diazo group attached to a benzyl ring. Its chemical formula is C10H9N3O3, and it is typically a white solid with high reactivity due to the diazo functionality. This compound is commonly used as an intermediate in synthetic chemistry for complex molecule development.

About

CAS No 82551-63-1
English Name 4-Nitrobenzyl 2-diazo-3-oxobutanoate
Molecular Formula C11H9N3O5
Molecular Weight 263.21 g/mol
SMILES CC(=O)C(=[N+]=[N-])C(=O)OCC1=CC=C(C=C1)[N+](=O)[O-]
InChIKey HEKGSEIAAGMGPL-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What are the main uses of 4-Nitrobenzyl 2-diazo-3-oxobutanoate (CAS: 82551-63-1)?

4-Nitrobenzyl 2-diazo-3-oxobutanoate (CAS: 82551-63-1) is primarily utilized in pharmaceutical resea...

Compound Q&A

Is 4-Nitrobenzyl 2-diazo-3-oxobutanoate (CAS: 82551-63-1) safe?

4-Nitrobenzyl 2-diazo-3-oxobutanoate (CAS: 82551-63-1) requires careful handling due to its potentia...

Compound Q&A

How should 4-Nitrobenzyl 2-diazo-3-oxobutanoate (CAS: 82551-63-1) be stored?

4-Nitrobenzyl 2-diazo-3-oxobutanoate (CAS: 82551-63-1) should be stored in a cool, dry place at 2-8°...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...