Compound Q&A

How should Methyl N-{[(2-methyl-2-propanyl)oxy]carbonyl}tyrosinate (CAS: 4326-36-7) be stored?

Answer

Store Methyl N-{[(2-methyl-2-propanyl)oxy]carbonyl}tyrosinate in a cool, dry, and dark place, ideally at 2-8°C. Keep it in a sealed container to prevent moisture absorption and contamination. Avoid exposure to air and light to maintain stability and prolong shelf life. Ensure storage in a well-ventilated area away from incompatible substances.

About

CAS No 4326-36-7

English Name Methyl N-{[(2-methyl-2-propanyl)oxy]carbonyl}tyrosinate

Molecular Formula C15H21NO5

Molecular Weight 295.33500000000004 g/mol

SMILES CC(C)(C)OC(=O)NC(CC1=CC=C(C=C1)O)C(=O)OC

InChIKey NQIFXJSLCUJHBB-LBPRGKRZSA-N

Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What is Methyl N-{[(2-methyl-2-propanyl)oxy]carbonyl}tyrosinate (CAS: 4326-36-7)?

Methyl N-{[(2-methyl-2-propanyl)oxy]carbonyl}tyrosinate is an organic compound with the CAS number 4...

Compound Q&A

What are the main uses of Methyl N-{[(2-methyl-2-propanyl)oxy]carbonyl}tyrosinate (CAS: 4326-36-7)?

This compound is primarily used in pharmaceutical research as a building block for drug development....

Compound Q&A

Is Methyl N-{[(2-methyl-2-propanyl)oxy]carbonyl}tyrosinate (CAS: 4326-36-7) safe?

Methyl N-{[(2-methyl-2-propanyl)oxy]carbonyl}tyrosinate is generally considered safe when handled pr...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...

Compound Q&A

How should (1R,9S,10S,12S,14E,16S,19R,20R,21S,22R)-3,9,21-Trihydroxy-5,10,12,14,16,20,22-heptamethyl-23,24-dioxatetracyclo[17.3.1.1~6,9~.0~2,7~]tetracosa-2,5,7,14-tetraen-4-one (CAS: 183202-73-5) be stored?

This compound should be stored in a cool, dry place away from direct sunlight. I...

183202-73-5(1R,9S,10S,12S,14E,1...

Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...

Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...

How should Methyl N-{[(2-methyl-2-propanyl)oxy]carbonyl}tyrosinate (CAS: 4326-36-7) be stored?

Answer

About

Related Q&A

What is Methyl N-{[(2-methyl-2-propanyl)oxy]carbonyl}tyrosinate (CAS: 4326-36-7)?

What are the main uses of Methyl N-{[(2-methyl-2-propanyl)oxy]carbonyl}tyrosinate (CAS: 4326-36-7)?

Is Methyl N-{[(2-methyl-2-propanyl)oxy]carbonyl}tyrosinate (CAS: 4326-36-7) safe?

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

How should (1R,9S,10S,12S,14E,16S,19R,20R,21S,22R)-3,9,21-Trihydroxy-5,10,12,14,16,20,22-heptamethyl-23,24-dioxatetracyclo[17.3.1.1~6,9~.0~2,7~]tetracosa-2,5,7,14-tetraen-4-one (CAS: 183202-73-5) be stored?

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

Suppliers

NaJingDeErNuoYiYao Technology Co Ltd

Shanghai Chupeptide Biotechnology Co., Ltd.

ShangHaiMaiRuiErShengHua Technology Co Ltd

Jin Jinle (Hunan) Chemical Co., Ltd.

Hubei Chenghai Chemical Co., Ltd.

HePeng （ ShangHai ） Biotechnology Co Ltd