Compound Q&A

What are the main uses of 2-Oxo-3-hydroadenosine (CAS: 1818-71-9)?

Answer

2-Oxo-3-hydroadenosine
2-Oxo-3-hydroadenosine (CAS: 1818-71-9) is mainly utilized in pharmaceutical research for investigating its potential as a therapeutic agent. It serves as a precursor in the synthesis of nucleoside derivatives and is studied for its role in metabolic pathways. Additionally, it is employed in biochemical studies to understand enzyme mechanisms and nucleic acid interactions. Its applications are limited to laboratory and research environments due to its specialized nature.

About

CAS No 1818-71-9
English Name 2-Oxo-3-hydroadenosine
Molecular Formula C10H13N5O5
Molecular Weight 283.24 g/mol
SMILES C1=NC2=C(NC(=O)N=C2N1C3C(C(C(O3)CO)O)O)N
InChIKey MIKUYHXYGGJMLM-UUOKFMHZSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What is 2-Oxo-3-hydroadenosine (CAS: 1818-71-9)?

2-Oxo-3-hydroadenosine (CAS: 1818-71-9) is a nucleoside analog with the chemical formula C10H13N5O5....

Compound Q&A

Is 2-Oxo-3-hydroadenosine (CAS: 1818-71-9) safe?

2-Oxo-3-hydroadenosine (CAS: 1818-71-9) is generally considered safe when handled properly in contro...

Compound Q&A

How should 2-Oxo-3-hydroadenosine (CAS: 1818-71-9) be stored?

2-Oxo-3-hydroadenosine (CAS: 1818-71-9) should be stored in a cool, dry place, away from direct ligh...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...