Compound Q&A

What are the main uses of 4-(Trifluoromethyl)benzoic acid (CAS: 455-24-3)?

Answer

4-(Trifluoromethyl)benzoic acid
4-(Trifluoromethyl)benzoic acid (CAS: 455-24-3) is widely used in pharmaceutical research as a building block for drug development. It also finds applications in the production of agrochemicals, dyes, and materials with enhanced thermal and chemical stability. Its unique fluorinated structure makes it valuable in creating compounds with specific biological activity and functional properties.

About

CAS No 455-24-3
English Name 4-(Trifluoromethyl)benzoic acid
Molecular Formula C8H5F3O2
Molecular Weight 190.12 g/mol
SMILES C1=CC(=CC=C1C(=O)O)C(F)(F)F
InChIKey SWKPKONEIZGROQ-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What is 4-(Trifluoromethyl)benzoic acid (CAS: 455-24-3)?

4-(Trifluoromethyl)benzoic acid (CAS: 455-24-3) is an organic compound with the chemical formula C8H...

Compound Q&A

Is 4-(Trifluoromethyl)benzoic acid (CAS: 455-24-3) safe?

4-(Trifluoromethyl)benzoic acid (CAS: 455-24-3) is considered to have moderate toxicity and should b...

Compound Q&A

How should 4-(Trifluoromethyl)benzoic acid (CAS: 455-24-3) be stored?

4-(Trifluoromethyl)benzoic acid (CAS: 455-24-3) should be stored in a cool, dry, and well-ventilated...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...