Compound Q&A

What are the main uses of (2S,3aS,7aS)-1-[(2S)-2-{[(2S)-1-Ethoxy-1-oxo-2-pentanyl]amino}propanoyl]octahydro-1H-indole-2-carboxylic acid - 2-methyl-2-propanamine (1:1) (CAS: 107133-36-8)?

Answer

(2S,3aS,7aS)-1-[(2S)-2-{[(2S)-1-Ethoxy-1-oxo-2-pentanyl]amino}propanoyl]octahydro-1H-indole-2-carboxylic acid - 2-methyl-2-propanamine (1:1) (non-preferred name)
This compound is primarily used in pharmaceutical research for its potential as a drug candidate, particularly in the development of treatments for neurological disorders. It may also be utilized in organic synthesis as a building block for more complex molecules. Due to its unique structure, it is of interest in biochemical studies and may find applications in medicinal chemistry and drug discovery.

About

English Name (2S,3aS,7aS)-1-[(2S)-2-{[(2S)-1-Ethoxy-1-oxo-2-pentanyl]amino}propanoyl]octahydro-1H-indole-2-carboxylic acid - 2-methyl-2-propanamine (1:1) (non-preferred name)
Molecular Formula C23H43N3O5
Molecular Weight 441.61 g/mol
SMILES CCCC(C(=O)OCC)NC(C)C(=O)N1C2CCCCC2CC1C(=O)O.CC(C)(C)N
InChIKey IYNMDWMQHSMDDE-MHXJNQAMSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What is (2S,3aS,7aS)-1-[(2S)-2-{[(2S)-1-Ethoxy-1-oxo-2-pentanyl]amino}propanoyl]octahydro-1H-indole-2-carboxylic acid - 2-methyl-2-propanamine (1:1) (CAS: 107133-36-8)?

This compound, with the CAS number 107133-36-8, is a complex organic molecule containing an indole r...

Compound Q&A

Is (2S,3aS,7aS)-1-[(2S)-2-{[(2S)-1-Ethoxy-1-oxo-2-pentanyl]amino}propanoyl]octahydro-1H-indole-2-carboxylic acid - 2-methyl-2-propanamine (1:1) (CAS: 107133-36-8) safe?

Safety data for this compound is limited, but as a research chemical, it is generally considered saf...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...