Compound Q&A

What is (E)-N-[(6-Chloro-3-pyridinyl)methyl]-N-ethyl-N'-methyl-2-nitro-1,1-ethenediamine (CAS: 150824-47-8)?

Answer

(E)-N-[(6-Chloro-3-pyridinyl)methyl]-N-ethyl-N'-methyl-2-nitro-1,1-ethenediamine
This compound is a synthetic organic molecule with the chemical formula C12H16ClN3O3. It is characterized by its ethenediamine backbone substituted with a chloropyridine group and two alkyl chains. It is known for its potential applications in medicinal chemistry and is often used as a building block in drug development due to its reactivity and structural versatility.

About

English Name (E)-N-[(6-Chloro-3-pyridinyl)methyl]-N-ethyl-N'-methyl-2-nitro-1,1-ethenediamine
Molecular Formula C11H15ClN4O2
Molecular Weight 270.71 g/mol
SMILES CCN(CC1=CN=C(C=C1)Cl)C(=C[N+](=O)[O-])NC
InChIKey CFRPSFYHXJZSBI-DHZHZOJOSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What are the main uses of (E)-N-[(6-Chloro-3-pyridinyl)methyl]-N-ethyl-N'-methyl-2-nitro-1,1-ethenediamine (CAS: 150824-47-8)?

This compound is primarily used in pharmaceutical research for the synthesis of various drugs and in...

Compound Q&A

Is (E)-N-[(6-Chloro-3-pyridinyl)methyl]-N-ethyl-N'-methyl-2-nitro-1,1-ethenediamine (CAS: 150824-47-8) safe?

Safety of this compound depends on its handling and application. It is generally considered toxic if...

Compound Q&A

How should (E)-N-[(6-Chloro-3-pyridinyl)methyl]-N-ethyl-N'-methyl-2-nitro-1,1-ethenediamine (CAS: 150824-47-8) be stored?

This compound should be stored in a cool, dry, and dark place to maintain its stability. It is best ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...