Compound Q&A

What is Ethyl 3-oxo-3-(2,4,5-trifluorophenyl)propanoate (CAS: 98349-24-7)?

Answer

Ethyl 3-oxo-3-(2,4,5-trifluorophenyl)propanoate
Ethyl 3-oxo-3-(2,4,5-trifluorophenyl)propanoate is an organic compound with the CAS number 98349-24-7. It is a derivative of propanoic acid, characterized by the presence of a ketone group and a 2,4,5-trifluorophenyl substituent. This compound is typically a colorless liquid with a moderate boiling point and is known for its stability under normal conditions.

About

CAS No 98349-24-7
English Name Ethyl 3-oxo-3-(2,4,5-trifluorophenyl)propanoate
Molecular Formula C11H9F3O3
Molecular Weight 246.18 g/mol
SMILES CCOC(=O)CC(=O)C1=CC(=C(C=C1F)F)F
InChIKey OTCJYVJORKMTHX-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What are the main uses of Ethyl 3-oxo-3-(2,4,5-trifluorophenyl)propanoate (CAS: 98349-24-7)?

Ethyl 3-oxo-3-(2,4,5-trifluorophenyl)propanoate is primarily used in pharmaceutical research as a bu...

Compound Q&A

Is Ethyl 3-oxo-3-(2,4,5-trifluorophenyl)propanoate (CAS: 98349-24-7) safe?

Ethyl 3-oxo-3-(2,4,5-trifluorophenyl)propanoate is generally considered safe when handled properly. ...

Compound Q&A

How should Ethyl 3-oxo-3-(2,4,5-trifluorophenyl)propanoate (CAS: 98349-24-7) be stored?

Ethyl 3-oxo-3-(2,4,5-trifluorophenyl)propanoate should be stored in a cool, dry, and well-ventilated...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...