Compound Q&A

What is (2R,3R)-2,3-Dihydroxysuccinic acid - 3-{5-[(2R)-2-aminopropyl]-7-cyano-2,3-dihydro-1H-indol-1-yl}propyl benzoate (1:1) (CAS: 239463-85-5)?

Answer

(2R,3R)-2,3-Dihydroxysuccinic acid - 3-{5-[(2R)-2-aminopropyl]-7-cyano-2,3-dihydro-1H-indol-1-yl}propyl benzoate (1:1)
This compound, with the CAS number 239463-85-5, is a complex organic molecule containing multiple functional groups. It features a dihydroxysuccinic acid backbone, a benzoate group, and a substituted indole ring. The molecule is known for its stereochemical configuration (2R,3R) and is often used in specialized chemical research due to its structural complexity and potential reactivity.

About

English Name (2R,3R)-2,3-Dihydroxysuccinic acid - 3-{5-[(2R)-2-aminopropyl]-7-cyano-2,3-dihydro-1H-indol-1-yl}propyl benzoate (1:1)
Molecular Formula C26H31N3O8
Molecular Weight 513.5 g/mol
EINECS 688-292-1
SMILES CC(CC1=CC2=C(C(=C1)C#N)N(CC2)CCCOC(=O)C3=CC=CC=C3)N.C(C(C(=O)O)O)(C(=O)O)O
InChIKey KYUCVOVGODORNE-NUFNRNBZSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of (2R,3R)-2,3-Dihydroxysuccinic acid - 3-{5-[(2R)-2-aminopropyl]-7-cyano-2,3-dihydro-1H-indol-1-yl}propyl benzoate (1:1) (CAS: 239463-85-5)?

This compound is primarily used in pharmaceutical research for its potential as a bioactive molecule...

Compound Q&A

Is (2R,3R)-2,3-Dihydroxysuccinic acid - 3-{5-[(2R)-2-aminopropyl]-7-cyano-2,3-dihydro-1H-indol-1-yl}propyl benzoate (1:1) (CAS: 239463-85-5) safe?

Safety data for this compound is limited, but as with many complex organic chemicals, it should be h...

Compound Q&A

How should (2R,3R)-2,3-Dihydroxysuccinic acid - 3-{5-[(2R)-2-aminopropyl]-7-cyano-2,3-dihydro-1H-indol-1-yl}propyl benzoate (1:1) (CAS: 239463-85-5) be stored?

This compound should be stored in a cool, dry place away from direct light. It is recommended to kee...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...