Compound Q&A

What are the main uses of 2-[4-(2,2-Dichlorocyclopropyl)phenoxy]-2-methylpropanoic acid (CAS: 52214-84-3)?

Answer

2-[4-(2,2-Dichlorocyclopropyl)phenoxy]-2-methylpropanoic acid
This compound is primarily used in pharmaceutical research as an intermediate for developing drugs targeting specific biological pathways. It also finds applications in agrochemicals and industrial processes due to its reactivity. Additionally, it is utilized in organic synthesis for creating derivatives with tailored properties, making it a valuable component in chemical research and development.

About

CAS No 52214-84-3
English Name 2-[4-(2,2-Dichlorocyclopropyl)phenoxy]-2-methylpropanoic acid
Molecular Formula C13H14Cl2O3
Molecular Weight 289.16 g/mol
SMILES CC(C)(C(=O)O)OC1=CC=C(C=C1)C2CC2(Cl)Cl
InChIKey KPSRODZRAIWAKH-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 2-[4-(2,2-Dichlorocyclopropyl)phenoxy]-2-methylpropanoic acid (CAS: 52214-84-3)?

2-[4-(2,2-Dichlorocyclopropyl)phenoxy]-2-methylpropanoic acid (CAS: 52214-84-3) is a synthetic organ...

Compound Q&A

Is 2-[4-(2,2-Dichlorocyclopropyl)phenoxy]-2-methylpropanoic acid (CAS: 52214-84-3) safe?

Safety of 2-[4-(2,2-Dichlorocyclopropyl)phenoxy]-2-methylpropanoic acid (CAS: 52214-84-3) depends on...

Compound Q&A

How should 2-[4-(2,2-Dichlorocyclopropyl)phenoxy]-2-m methylpropanoic acid (CAS: 52214-84-3) be stored?

Store 2-[4-(2,2-Dichlorocyclopropyl)phenoxy]-2-methylpropanoic acid (CAS: 52214-84-3) in a cool, dry...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...