Compound Q&A

What is 4-({[(4-oxopent-2-en-2-yl)oxy]nickelio}oxy)pent-3-en-2-one (CAS: 3264-82-2)?

Answer

4-({[(4-oxopent-2-en-2-yl)oxy]nickelio}oxy)pent-3-en-2-one
4-({[(4-oxopent-2-en-2-yl)oxy]nickelio}oxy)pent-3-en-2-one (CAS: 3264-82-2) is a nickel-containing organic compound with a complex structure featuring two pent-3-en-2-one groups connected via a nickel-oxygen bridge. It exhibits unique chemical reactivity due to its conjugated double bonds and coordination chemistry properties, making it relevant in specialized chemical applications. Its molecular formula is C10H16O4Ni, and it is typically a solid at room temperature with moderate solubility in organic solvents.

About

CAS No 3264-82-2
English Name 4-({[(4-oxopent-2-en-2-yl)oxy]nickelio}oxy)pent-3-en-2-one
Molecular Formula C10H14NiO4
Molecular Weight 256.91 g/mol
SMILES CC(=CC(=O)C)[O-].CC(=CC(=O)C)[O-].[Ni+2]
InChIKey BMGNSKKZFQMGDH-UHFFFAOYSA-L
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of 4-({[(4-oxopent-2-en-2-yl)oxy]nickelio}oxy)pent-3-en-2-one (CAS: 3264-82-2)?

This compound is primarily used in pharmaceutical research as a potential drug intermediate and in i...

Compound Q&A

Is 4-({[(4-oxopent-2-en-2-yl)oxy]nickelio}oxy)pent-3-en-2-one (CAS: 3264-82-2) safe?

Safety of 4-({[(4-oxopent-2-en-2-yl)oxy]nickelio}oxy)pent-3-en-2-one (CAS: 3264-82-2) depends on han...

Compound Q&A

How should 4-({[(4-oxopent-2-en-2-yl)oxy]nickelio}oxy)pent-3-en-2-one (CAS: 3264-82-2) be stored?

Store 4-({[(4-oxopent-2-en-2-yl)oxy]nickelio}oxy)pent-3-en-2-one (CAS: 3264-82-2) in a cool, dry pla...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...