Compound Q&A

What are the main uses of 4-(Methylsulfonyl)phenylacetic acid (CAS: 90536-66-6)?

Answer

4-(Methylsulfonyl)phenylacetic acid
4-(Methylsulfonyl)phenylacetic acid (CAS: 90536-66-6) is primarily used in pharmaceutical research as a building block for drug development. It also finds applications in organic synthesis, specialty chemicals, and as a precursor for other functional compounds. Its versatility makes it valuable in the creation of bioactive molecules and agrochemicals.

About

CAS No 90536-66-6
English Name 4-(Methylsulfonyl)phenylacetic acid
Molecular Formula C9H10O4S
Molecular Weight 214.24 g/mol
SMILES CS(=O)(=O)C1=CC=C(C=C1)CC(=O)O
InChIKey HGGWOSYNRVOQJH-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 4-(Methylsulfonyl)phenylacetic acid (CAS: 90536-66-6)?

4-(Methylsulfonyl)phenylacetic acid (CAS: 90536-66-6) is an organic compound with the chemical formu...

Compound Q&A

Is 4-(Methylsulfonyl)phenylacetic acid (CAS: 90536-66-6) safe?

4-(Methylsulfonyl)phenylacetic acid (CAS: 90536-66-6) is generally considered safe when handled prop...

Compound Q&A

How should 4-(Methylsulfonyl)phenylacetic acid (CAS: 90536-66-6) be stored?

4-(Methylsulfonyl)phenylacetic acid (CAS: 90536-66-6) should be stored in a cool, dry, and well-vent...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...