Compound Q&A

What are the main uses of 4-Bromodibenzofuran (CAS: 89827-45-2)?

Answer

4-Bromodibenzofuran
4-Bromodibenzofuran (CAS: 89827-45-2) is primarily used in pharmaceutical research as a precursor for synthesizing bioactive compounds, including potential drug candidates. It also finds applications in organic chemistry for creating functionalized derivatives and in materials science for polymer development. Additionally, it serves as a reference standard in chemical analysis and research studies. Its unique structure makes it valuable in various industrial and academic contexts.

About

CAS No 89827-45-2
English Name 4-Bromodibenzofuran
Molecular Formula C12H7BrO
Molecular Weight 247.09 g/mol
SMILES C1=CC=C2C(=C1)C3=C(O2)C(=CC=C3)Br
InChIKey DYTYBRPMNQQFFL-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 4-Bromodibenzofuran (CAS: 89827-45-2)?

4-Bromodibenzofuran is an aromatic organic compound with the chemical formula C12H9BrO. It features ...

Compound Q&A

Is 4-Bromodibenzofuran (CAS: 89827-45-2) safe?

4-Bromodibenzofuran (CAS: 89827-45-2) is considered a hazardous substance due to its brominated arom...

Compound Q&A

How should 4-Bromodibenzofuran (CAS: 89827-45-2) be stored?

4-Bromodibenzofuran (CAS: 89827-45-2) should be stored in a cool, dry, and dark place, ideally at 25...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...