Compound Q&A

What is 4-{[4-(Diethylamino)phenyl](phenyl)methylene}-N,N-diethyl-2,5-cyclohexadien-1-iminium hydrogen sulfate (CAS: 633-03-4)?

Answer

4-{[4-(Diethylamino)phenyl](phenyl)methylene}-N,N-diethyl-2,5-cyclohexadien-1-iminium hydrogen sulfate
4-{[4-(Diethylamino)phenyl](phenyl)methylene}-N,N-diethyl-2,5-cyclohexadien-1-iminium hydrogen sulfate, with CAS number 633-03-4, is a synthetic organic compound that functions as a photosensitizer. It contains a diarylmethane scaffold and is known for its ability to absorb light and generate reactive species, making it useful in various chemical applications. The compound is typically used in its protonated form and is characterized by its yellowish color and solubility in polar solvents.

About

CAS No 633-03-4
English Name 4-{[4-(Diethylamino)phenyl](phenyl)methylene}-N,N-diethyl-2,5-cyclohexadien-1-iminium hydrogen sulfate
Molecular Formula C27H34N2O4S
Molecular Weight 482.63 g/mol
SMILES [O-]S(=O)(=O)O.CCN(c1ccc(cc1)/C(=C/1\C=CC(=[N+](CC)CC)C=C1)/c1ccccc1)CC
InChIKey NNBFNNNWANBMTI-UHFFFAOYSA-M
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of 4-{[4-(Diethylamino)phenyl](phenyl)methylene}-N,N-diethyl-2,5-cyclohexadien-1-iminium hydrogen sulfate (CAS: 633-03-4)?

This compound is primarily used in pharmaceutical research as a photosensitizer for photodynamic the...

Compound Q&A

Is 4-{[4-(Diethylamino)phenyl](phenyl)methylene}-N,N-diethyl-2,5-cyclohexadien-1-iminium hydrogen sulfate (CAS: 633-03-4) safe?

The safety of 4-{[4-(Diethylamino)phenyl](phenyl)methylene}-N,N-diethyl-2,5-cyclohexadien-1-iminium ...

Compound Q&A

How should 4-{[4-(Diethylamino)phenyl](phenyl)methylene}-N,N-diethyl-2,5-cyclohexadien-1-iminium hydrogen sulfate (CAS: 633-03-4) be stored?

This compound should be stored in a cool, dry, and dark location to maintain its stability and preve...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...