Compound Q&A

How should [(4-Amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]acetic acid (CAS: 69377-81-7) be stored?

Answer

[(4-Amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]acetic acid
[(4-Amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]acetic acid should be stored in a cool, dry place away from direct light. It is best kept in a sealed, airtight container to prevent moisture absorption. Due to its chemical nature, it should be stored at a temperature below 25°C and in a well-ventilated area to maintain stability and ensure safety during handling.

About

CAS No 69377-81-7
English Name [(4-Amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]acetic acid
Molecular Formula C7H5Cl2FN2O3
Molecular Weight 255.03 g/mol
SMILES C(C(=O)O)OC1=NC(=C(C(=C1Cl)N)Cl)F
InChIKey MEFQWPUMEMWTJP-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is [(4-Amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]acetic acid (CAS: 69377-81-7)?

[(4-Amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]acetic acid, with the CAS number 69377-81-7, is a sy...

Compound Q&A

What are the main uses of [(4-Amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]acetic acid (CAS: 69377-81-7)?

This compound is primarily used in pharmaceutical research as an intermediate in the synthesis of va...

Compound Q&A

Is [(4-Amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]acetic acid (CAS: 69377-81-7) safe?

[(4-Amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]acetic acid is generally considered safe when handle...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...