Compound Q&A

How should Grubbs' 1st generation catalyst (CAS: 172222-30-9) be stored?

Answer

Grubbs' 1st generation catalyst
Grubbs' 1st generation catalyst (CAS: 172222-30-9) should be stored in a cool, dry, and dark place to maintain its stability and activity. It is typically kept in a sealed container away from moisture and air exposure. Proper storage conditions include maintaining a temperature below 25°C and avoiding exposure to light. Always store it in a well-ventilated area to prevent any potential hazards.

About

English Name Grubbs' 1st generation catalyst
Molecular Formula C43H72Cl2P2Ru
Molecular Weight 822.97 g/mol
SMILES Cl/[Ru](Cl)=C/C1=CC=CC=C1.C2(P(C3CCCCC3)C4CCCCC4)CCCCC2.C5(P(C6CCCCC6)C7CCCCC7)CCCCC5
InChIKey PNPBGYBHLCEVMK-UHFFFAOYSA-L
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is Grubbs' 1st generation catalyst (CAS: 172222-30-9)?

Grubbs' 1st generation catalyst (CAS: 172222-30-9) is a ruthenium-based compound used in olefin meta...

Compound Q&A

What are the main uses of Grubbs' 1st generation catalyst (CAS: 172222-30-9)?

Grubbs' 1st generation catalyst (CAS: 172222-30-9) is widely used in pharmaceutical research, polyme...

Compound Q&A

Is Grubbs' 1st generation catalyst (CAS: 172222-30-9) safe?

Grubbs' 1st generation catalyst (CAS: 172222-30-9) is generally considered safe when handled properl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...