Compound Q&A

Is 5,5'-(1,1,1,3,3,3-Hexafluoro-2,2-propanediyl)bis(2-benzofuran-1,3-dione) (CAS: 1107-00-2) safe?

Answer

5,5'-(1,1,1,3,3,3-Hexafluoro-2,2-propanediyl)bis(2-benzofuran-1,3-dione)
Safety precautions are essential when handling this compound due to its fluorinated structure. While specific toxicity data may vary, it is generally considered hazardous if inhaled or ingested. Protective measures include using gloves, goggles, and ensuring proper ventilation. Adherence to safety standards like OSHA and EPA guidelines is recommended to minimize exposure risks during synthesis or application.

About

CAS No 1107-00-2
English Name 5,5'-(1,1,1,3,3,3-Hexafluoro-2,2-propanediyl)bis(2-benzofuran-1,3-dione)
Molecular Formula C19H6F6O6
Molecular Weight 444.24 g/mol
SMILES FC(F)(F)C(C1=CC2=C(C(OC2=O)=O)C=C1)(C3=CC4=C(C(OC4=O)=O)C=C3)C(F)(F)F
InChIKey QHHKLPCQTTWFSS-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 5,5'-(1,1,1,3,3,3-Hexafluoro-2,2-propanediyl)bis(2-benzofuran-1,3-dione) (CAS: 1107-00-2)?

5,5'-(1,1,1,3,3,3-Hexafluoro-2,2-propanediyl)bis(2-benzofuran-1,3-dione), with CAS number 1107-00-2,...

Compound Q&A

What are the main uses of 5,5'-(1,1,1,3,3,3-Hexafluoro-2,2-propanediyl)bis(2-benzofuran-1,3-dione) (CAS: 1107-00-2)?

This compound is primarily used in pharmaceutical research as a building block for drug development,...

Compound Q&A

How should 5,5'-(1,1,1,3,3,3-Hexafluoro-2,2-propanediyl)bis(2-benzofuran-1,3-dione) (CAS: 1107-00-2) be stored?

Store this compound in a cool, dry, and dark place, preferably at 2-8°C, to maintain stability. Keep...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...