Compound Q&A

What are the main uses of 2-(5H-Chromeno[2,3-b]pyridin-7-yl)propanoic acid (CAS: 52549-17-4)?

Answer

2-(5H-Chromeno[2,3-b]pyridin-7-yl)propanoic acid
2-(5H-Chromeno[2,3-b]pyridin-7-yl)propanoic acid (CAS: 52549-17-4) is primarily used in pharmaceutical research for the development of drugs targeting specific biological pathways. It serves as an intermediate in the synthesis of compounds with potential anti-inflammatory, antimicrobial, and antitumor properties. Additionally, it may find applications in organic synthesis and chemical research due to its structural versatility.

About

CAS No 52549-17-4
English Name 2-(5H-Chromeno[2,3-b]pyridin-7-yl)propanoic acid
Molecular Formula C15H13NO3
Molecular Weight 255.27 g/mol
SMILES CC(C1=CC2=C(C=C1)OC3=C(C2)C=CC=N3)C(=O)O
InChIKey TVQZAMVBTVNYLA-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 2-(5H-Chromeno[2,3-b]pyridin-7-yl)propanoic acid (CAS: 52549-17-4)?

2-(5H-Chromeno[2,3-b]pyridin-7-yl)propanoic acid is a chemical compound with the CAS number 52549-17...

Compound Q&A

Is 2-(5H-Chromeno[2,3-b]pyridin-7-yl)propanoic acid (CAS: 52549-17-4) safe?

2-(5H-Chromeno[2,3-b]pyridin-7-yl)propanoic acid (CAS: 52549-17-4) is generally considered safe when...

Compound Q&A

How should 2-(5H-Chromeno[2,3-b]pyridin-7-yl)propanoic acid (CAS: 52549-17-4) be stored?

2-(5H-Chromeno[2,3-b]pyridin-7-yl)propanoic acid (CAS: 52549-17-4) should be stored in a cool, dry, ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...