Compound Q&A

What is 2-Fluoro-1-methyl-4-nitrobenzene (CAS: 1427-07-2)?

Answer

2-Fluoro-1-methyl-4-nitrobenzene
2-Fluoro-1-methyl-4-nitrobenzene (CAS: 1427-07-2) is an aromatic organic compound with the chemical formula C7H6FN2O. It features a benzene ring substituted with a fluorine atom at position 2, a methyl group at position 1, and a nitro group at position 4. This compound is known for its stability and is commonly used in synthetic chemistry due to its reactivity and structural versatility.

About

CAS No 1427-07-2
English Name 2-Fluoro-1-methyl-4-nitrobenzene
Molecular Formula C7H6FNO2
Molecular Weight 155.13 g/mol
SMILES CC1=C(C=C(C=C1)[N+](=O)[O-])F
InChIKey WIQISTBTOQNVCE-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of 2-Fluoro-1-methyl-4-nitrobenzene (CAS: 1427-07-2)?

2-Fluoro-1-methyl-4-nitrobenzene (CAS: 1427-07-2) is primarily used as an intermediate in pharmaceut...

Compound Q&A

Is 2-Fluoro-1-methyl-4-nitrobenzene (CAS: 1427-07-2) safe?

2-Fluoro-1-methyl-4-nitrobenzene (CAS: 1427-07-2) requires careful handling due to potential toxicit...

Compound Q&A

How should 2-Fluoro-1-methyl-4-nitrobenzene (CAS: 1427-07-2) be stored?

2-Fluoro-1-methyl-4-nitrobenzene (CAS: 1427-07-2) should be stored in a cool, dry place, away from l...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...