Compound Q&A

What is 1,1-Diphenylmethanamine (CAS: 91-00-9)?

Answer

1,1-Diphenylmethanamine
1,1-Diphenylmethanamine, with the CAS number 91-00-9, is an organic compound that serves as a key intermediate in the synthesis of various pharmaceuticals and chemicals. It has the molecular formula C13H14N and is known for its aromatic structure and amine functionality. This compound is typically a white solid at room temperature and is used in chemical research for its reactivity and versatility in forming derivatives.

About

CAS No 91-00-9
English Name 1,1-Diphenylmethanamine
Molecular Formula C13H13N
Molecular Weight 183.25 g/mol
SMILES C1=CC=C(C=C1)C(C2=CC=CC=C2)N
InChIKey MGHPNCMVUAKAIE-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of 1,1-Diphenylmethanamine (CAS: 91-00-9)?

1,1-Diphenylmethanamine (CAS: 91-00-9) is widely used in the pharmaceutical industry for the synthes...

Compound Q&A

Is 1,1-Diphenylmethanamine (CAS: 91-00-9) safe?

1,1-Diphenylmethanamine (CAS: 91-00-9) is generally considered safe when handled properly, but it sh...

Compound Q&A

How should 1,1-Diphenylmethanamine (CAS: 91-00-9) be stored?

1,1-Diphenylmethanamine (CAS: 91-00-9) should be stored in a cool, dry, and dark place to maintain i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...