Compound Q&A

What is 4,4'-Diaminostilbene-2,2'-disulfonic acid (CAS: 81-11-8)?

Answer

4,4'-Diaminostilbene-2,2'-disulfonic acid
4,4'-Diaminostilbene-2,2'-disulfonic acid (CAS: 81-11-8) is an organic compound with the chemical formula C14H12N2O6S2. It is a white crystalline solid, commonly used as a pH indicator and dye. The compound is known for its strong absorption in the visible spectrum and its ability to change color with pH, making it valuable in analytical chemistry applications.

About

CAS No 81-11-8
English Name 4,4'-Diaminostilbene-2,2'-disulfonic acid
Molecular Formula C14H14N2O6S2
Molecular Weight 370.4 g/mol
SMILES C1=CC(=C(C=C1N)S(=O)(=O)O)C=CC2=C(C=C(C=C2)N)S(=O)(=O)O
InChIKey REJHVSOVQBJEBF-OWOJBTEDSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of 4,4'-Diaminostilbene-2,2'-disulfonic acid (CAS: 81-11-8)?

4,4'-Diaminostilbene-2,2'-disulfonic acid (CAS: 81-11-8) is widely used as a pH indicator, particula...

Compound Q&A

Is 4,4'-Diaminostilbene-2,2'-disulfonic acid (CAS: 81-11-8) safe?

4,4'-Diaminostilbene-2,2'-disulfonic acid (CAS: 81-11-8) is generally considered safe when handled p...

Compound Q&A

How should 4,4'-Diaminostilbene-2,2'-disulfonic acid (CAS: 81-11-8) be stored?

4,4'-Diaminostilbene-2,2'-disulfonic acid (CAS: 81-11-8) should be stored in a cool, dry, and dark p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...